Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C590031-250mg
|
250mg |
2
|
$63.90
|
|
|
C590031-1g
|
1g |
1
|
$176.90
|
|
| Synonyms | CCG-356380 | NSC16118 | 4-phenyl-cyclohexan-1-ol | 4-Phenylcyclohexan-1-ol | cis-4-phenylcyclohexanol | Z335244834 | EINECS 226-613-5 | Cyclohexanol, 4-phenyl- | EN300-6222305 | NSC 17139 | doi:10.14272/YVVUSIMLVPJXMY-HAQNSBGRSA-N | (trans)-4-Phenylcycloh |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Desiccated |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Secondary alcohols |
| Direct Parent | Cyclohexanols |
| Alternative Parents | Benzene and substituted derivatives Cyclic alcohols and derivatives Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Cyclohexanol - Benzenoid - Monocyclic benzene moiety - Cyclic alcohol - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclohexanols. These are compounds containing an alcohol group attached to a cyclohexane ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-phenylcyclohexan-1-ol |
|---|---|
| INCHI | InChI=1S/C12H16O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11-13H,6-9H2 |
| InChIKey | YVVUSIMLVPJXMY-UHFFFAOYSA-N |
| Smiles | C1CC(CCC1C2=CC=CC=C2)O |
| Isomeric SMILES | C1CC(CCC1C2=CC=CC=C2)O |
| Alternate CAS | 5437-46-7,5769-13-1,7335-12-8 |
| NSC Number | 16118 |
| Molecular Weight | 176.25 |
| Reaxy-Rn | 2415218 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2415218&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 24, 2024 | C590031 | |
| Certificate of Analysis | Jan 24, 2024 | C590031 | |
| Certificate of Analysis | Jan 24, 2024 | C590031 | |
| Certificate of Analysis | Jan 24, 2024 | C590031 |
| Molecular Weight | 176.250 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 176.12 Da |
| Monoisotopic Mass | 176.12 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 141.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |