Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C177782-1g
|
1g |
2
|
$280.90
|
|
| Synonyms | 869481-94-7 | cis-3,4-Difluoropyrrolidine hydrochloride | CIS-3,4-DIFLUOROPYRROLIDINE HCL | (3S,4R)-rel-3,4-Difluoropyrrolidine hydrochloride | (3R,4S)-3,4-difluoropyrrolidine;hydrochloride | (3R,4S)-3,4-difluoropyrrolidine hydrochloride | MFCD20230545 | SCHEMBL1026466 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Nitrogen mustard compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrogen mustard compounds |
| Alternative Parents | Pyrrolidines Dialkylamines Azacyclic compounds Organofluorides Hydrochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Nitrogen mustard - Pyrrolidine - Azacycle - Organoheterocyclic compound - Secondary amine - Secondary aliphatic amine - Hydrocarbon derivative - Hydrochloride - Organofluoride - Organohalogen compound - Amine - Alkyl halide - Alkyl fluoride - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrogen mustard compounds. These are compounds having two beta-haloalkyl groups bound to a nitrogen atom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504771864 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771864 |
| IUPAC Name | (3S,4R)-3,4-difluoropyrrolidine;hydrochloride |
| INCHI | InChI=1S/C4H7F2N.ClH/c5-3-1-7-2-4(3)6;/h3-4,7H,1-2H2;1H/t3-,4+; |
| InChIKey | JDUYOMPVOXGHIR-HKTIBRIUSA-N |
| Smiles | C1C(C(CN1)F)F.Cl |
| Isomeric SMILES | C1[C@H]([C@H](CN1)F)F.Cl |
| PubChem CID | 66880882 |
| Molecular Weight | 143.56 |
| Sensitivity | Hygroscopic |
|---|---|
| Molecular Weight | 143.560 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 143.031 Da |
| Monoisotopic Mass | 143.031 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 58.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |