Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C153348-1ml
|
1ml |
3
|
$24.90
|
|
| Synonyms | c-1,3-dimethylcyclohexane | 1,3-Dimethylcyclohexane, cis- | DTXSID30858738 | 1,3-dimethyl(cis)-cyclohexane | AKOS025295579 | Cyclohexane, cis-1,3-dimethyl- | REL-(1R,3S)-1,3-DIMETHYLCYCLOHEXANE | (Z)-1,3-Dimethylcyclohexane | D1055 | 1,cis-3-Dimethylcyclo |
|---|---|
| Specifications & Purity | ≥99% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Product Description |
cis-1,3-Dimethylcyclohexane undergoes ring opening reaction via dicarbene mechanism in the presence of iridium catalyst supported on SiO2
|
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Hydrocarbons |
| Class | Saturated hydrocarbons |
| Subclass | Cycloalkanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cycloalkanes |
| Alternative Parents | Not available |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cycloalkane - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cycloalkanes. These are saturated monocyclic hydrocarbons (with or without side chains). |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504758121 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758121 |
| IUPAC Name | (1R,3S)-1,3-dimethylcyclohexane |
| INCHI | InChI=1S/C8H16/c1-7-4-3-5-8(2)6-7/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | SGVUHPSBDNVHKL-OCAPTIKFSA-N |
| Smiles | CC1CCCC(C1)C |
| Isomeric SMILES | C[C@@H]1CCC[C@@H](C1)C |
| WGK Germany | 3 |
| UN Number | 2263 |
| Packing Group | II |
| Molecular Weight | 112.22 |
| Beilstein | 5,36 |
| Reaxy-Rn | 1900339 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1900339&ln= |
| Refractive Index | 1.42 |
|---|---|
| Flash Point(°F) | 42.8 °F |
| Flash Point(°C) | 6°C(lit.) |
| Boil Point(°C) | 120°C(lit.) |
| Molecular Weight | 112.210 g/mol |
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 112.125 Da |
| Monoisotopic Mass | 112.125 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 58.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xianjie Wang, Jingdong Gou, Louwei Cui, Jinhui He, Xue Ma, Yaning Zhao, Liuyi Pan, Huiyong Chen, Zhe Jin, Hongyan Wang, Yonghong Zhu, Dong Li. (2025) Carbon molecular sieves for real industrial feedstock separation of C8 cycloalkanes: A study on pore size distribution and surface functionalization. SEPARATION AND PURIFICATION TECHNOLOGY, 364 (132505). |