Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C349599-5g
|
5g |
1
|
$116.90
|
|
| Synonyms | Chlorotriisobutylsilane, 99% | Chlorotriisobutylsilane | FT-0636817 | DTXSID70325737 | TRI-N-OCTYLTINHYDRIDE | J-006019 | SCHEMBL549136 | MFCD00010658 | Triisobutylchlorosilane | triisobutyl-chlorosilane | Silane,chlorotris(2-methylpropyl)- | NSC516680 | |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes - Trialkylheterosilanes |
| Direct Parent | Trialkylchlorosilanes |
| Alternative Parents | Silyl monohalides Organochlorosilanes Organic metalloid salts Alkylhalosilanes Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylchlorosilane - Silyl monohalide - Organochlorosilane - Organic metalloid salt - Alkylhalosilane - Hydrocarbon derivative - Organic salt - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylchlorosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one chlorine atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | chloro-tris(2-methylpropyl)silane |
|---|---|
| INCHI | InChI=1S/C12H27ClSi/c1-10(2)7-14(13,8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3 |
| InChIKey | TZPZCTBZJKZFGY-UHFFFAOYSA-N |
| Smiles | CC(C)C[Si](CC(C)C)(CC(C)C)Cl |
| Isomeric SMILES | CC(C)C[Si](CC(C)C)(CC(C)C)Cl |
| WGK Germany | 3 |
| Molecular Weight | 234.88 |
| Reaxy-Rn | 2409275 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2409275&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 24, 2022 | C349599 |
| Sensitivity | Moisture sensitive |
|---|---|
| Flash Point(°F) | 188.6 °F |
| Flash Point(°C) | 87 °C |
| Molecular Weight | 234.880 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 6 |
| Exact Mass | 234.157 Da |
| Monoisotopic Mass | 234.157 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 126.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $29.90