E2515254Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | 2-Chloromethoxy-propane | F8888-3183 | 2-(chloromethyloxy)propane | 4-(2-Aminothiazol-4-yl)-1-phenylazetidin-2-one | GSGPUGZLDGHFDO-UHFFFAOYSA-N | AKOS006377409 | Chloromethyl isopropyl ether | CHLOROMETHYL ISO-PROPYL ETHER | 2-(chloromethoxy)propane | A8 |
|---|---|
| Specifications & Purity | technical grade |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Grade | technical grade |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
-
Superclass
Organic oxygen compounds
-
Class
Organooxygen compounds
- Subclass Ethers
-
Class
Organooxygen compounds
-
Superclass
Organic oxygen compounds
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dialkyl ethers |
| Alternative Parents | Organochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dialkyl ether - Hydrocarbon derivative - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkyl ethers. These are organic compounds containing the dialkyl ether functional group, with the formula ROR', where R and R' are alkyl groups. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| Pubchem Sid | 504767108 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767108 |
| IUPAC Name | 2-(chloromethoxy)propane |
| INCHI | InChI=1S/C4H9ClO/c1-4(2)6-3-5/h4H,3H2,1-2H3 |
| InChIKey | GSGPUGZLDGHFDO-UHFFFAOYSA-N |
| Smiles | CC(C)OCCl |
| Isomeric SMILES | CC(C)OCCl |
| Molecular Weight | 108.57 |
| Reaxy-Rn | 1731499 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1731499&ln= |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Molecular Weight | 108.570 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 108.034 Da |
| Monoisotopic Mass | 108.034 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 28.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later