Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C349189-1g
|
1g |
2
|
$112.90
|
|
|
C349189-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$338.90
|
|
| Synonyms | 2-chloro-2-fluoroacetic acid | AKOS006343239 | MFCD19228891 | SY276751 | FT-0676800 | MFCD00871521 | MFCD19229828 | SY276752 | EN300-149523 | Acetic acid, chlorofluoro- | NSC 95117 | SCHEMBL11879523 | SCHEMBL301084 | SY275169 | C2H2ClFO2 | 2-Chloro-2-fluo |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature,Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Alpha-halocarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alpha-halocarboxylic acids |
| Alternative Parents | Monocarboxylic acids and derivatives Carboxylic acids Organofluorides Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alpha-halocarboxylic acid - Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organofluoride - Organochloride - Organohalogen compound - Carbonyl group - Alkyl halide - Alkyl fluoride - Alkyl chloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha-halocarboxylic acids. These are carboxylic acids containing a halogen atom bonded to the alpha carbon atom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504756397 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504756397 |
| IUPAC Name | 2-chloro-2-fluoroacetic acid |
| INCHI | InChI=1S/C2H2ClFO2/c3-1(4)2(5)6/h1H,(H,5,6) |
| InChIKey | JBIKZDFUXGHTHD-UHFFFAOYSA-N |
| Smiles | C(C(=O)O)(F)Cl |
| Isomeric SMILES | C(C(=O)O)(F)Cl |
| UN Number | 3265 |
| Packing Group | III |
| Molecular Weight | 112.49 |
| Reaxy-Rn | 1743034 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1743034&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Dec 16, 2023 | C349189 | |
| Certificate of Analysis | Dec 16, 2023 | C349189 | |
| Certificate of Analysis | Dec 16, 2023 | C349189 | |
| Certificate of Analysis | Dec 16, 2023 | C349189 |
| Sensitivity | Moisture sensitive |
|---|---|
| Flash Point(°C) | 59 °C |
| Boil Point(°C) | 162° C |
| Molecular Weight | 112.490 g/mol |
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 111.973 Da |
| Monoisotopic Mass | 111.973 Da |
| Topological Polar Surface Area | 37.300 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 64.599 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |