Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B755526-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$214.90
|
|
| Specifications & Purity | Ultra pure, ≥98%(T), non-zwitterionic buffer useful in pH range 6.3-9.5 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Grade | Ultra pure |
| Product Description |
A non-zwitterionic buffer (Absorbance: <0.08 at 260 nm, 1.0 M, H2O) that is useful near physiological pH (6.3-9.5). Has a pKa of 6.8 at 25°C. A non-zwitterionic buffer that is useful in the pH 6.3-9.5 range. Has pKas of 6.8 (pKa1) and 9.0 (pKa2). Absorbance (1.0 M, H2O, 260 nm): <0.08. Application:
|
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Alkanolamines |
| Direct Parent | 1,2-aminoalcohols |
| Alternative Parents | Dialkylamines Primary alcohols Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | 1,2-aminoalcohol - Secondary amine - Secondary aliphatic amine - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,2-aminoalcohols. These are organic compounds containing an alkyl chain with an amine group bound to the C1 atom and an alcohol group bound to the C2 atom. |
| External Descriptors | hexol |
|
|
|
| IUPAC Name | 2-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propylamino]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| INCHI | InChI=1S/C11H26N2O6/c14-4-10(5-15,6-16)12-2-1-3-13-11(7-17,8-18)9-19/h12-19H,1-9H2 |
| InChIKey | HHKZCCWKTZRCCL-UHFFFAOYSA-N |
| Smiles | C(CNC(CO)(CO)CO)CNC(CO)(CO)CO |
| Isomeric SMILES | C(CNC(CO)(CO)CO)CNC(CO)(CO)CO |
| WGK Germany | 3 |
| Molecular Weight | 282.33 |
| Beilstein | 1786109 |
| Reaxy-Rn | 1786109 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1786109&ln= |
| Solubility | water: 1 M |
|---|---|
| Melt Point(°C) | 164-165°C |
| Molecular Weight | 282.330 g/mol |
| XLogP3 | -4.600 |
| Hydrogen Bond Donor Count | 8 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 12 |
| Exact Mass | 282.179 Da |
| Monoisotopic Mass | 282.179 Da |
| Topological Polar Surface Area | 145.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 183.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jie Gu, Shuyun Zheng, Xiaolong Lu, Hao Zhang, Kai Ren, Ziqiang Liu, Chao Liu, Chunrui Wu. (2024) A new strategy for solving hydrophobic membrane wetting: membrane structure design for membrane pore drying by spontaneous dehydration. JOURNAL OF MEMBRANE SCIENCE, (123664). |
| 2. Jiandong Shen, Bijiang Zhong, Wenshui Xia, Yanshun Xu. (2024) Action of structural proteins in textural deterioration of grass carp (Ctenopharyngodon idellus) fillets during refrigerated storage. INTERNATIONAL JOURNAL OF FOOD SCIENCE AND TECHNOLOGY, 59 (4): (2659-2666). |
| 3. Seokjoon Kim, Seungjin Lee, Seokhwan Kim, Jiye Shin, Byung Seok Cha, Eun Sung Lee, Ki Soo Park. (2024) Colorimetric detection of arsenite using Tris-mediated gold nanoparticle aggregation and chitosan lateral flow strip-based signal enhancement. SENSORS AND ACTUATORS B-CHEMICAL, 407 (135469). |