Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B405281-200mg
|
200mg |
3
|
$168.90
|
|
|
B405281-1g
|
1g |
2
|
$511.90
|
|
| Synonyms | MFCD32062854 | 1-bromo-3-[(3-bromophenyl)-phenylphosphoryl]benzene | SY237589 | 1163698-32-5 | B5531 | Bis(3-bromophenyl)phenylphosphine oxide | D89141 | bis(3-bromophenyl)(phenyl)phosphine oxide | SCHEMBL13074801 |
|---|---|
| Specifications & Purity | ≥98% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylphosphines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylphosphines and derivatives |
| Alternative Parents | Bromobenzenes Aryl bromides Organophosphorus compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Triphenylphosphine - Phenylphosphine - Halobenzene - Bromobenzene - Aryl halide - Aryl bromide - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organobromide - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylphosphines and derivatives. These are compounds containing a phenylphosphine, which consists of phosphine substituent bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504771708 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771708 |
| IUPAC Name | 1-bromo-3-[(3-bromophenyl)-phenylphosphoryl]benzene |
| INCHI | InChI=1S/C18H13Br2OP/c19-14-6-4-10-17(12-14)22(21,16-8-2-1-3-9-16)18-11-5-7-15(20)13-18/h1-13H |
| InChIKey | PKHKPLVXRYPWPO-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)P(=O)(C2=CC(=CC=C2)Br)C3=CC(=CC=C3)Br |
| Isomeric SMILES | C1=CC=C(C=C1)P(=O)(C2=CC(=CC=C2)Br)C3=CC(=CC=C3)Br |
| Molecular Weight | 436.08 |
| Reaxy-Rn | 30554697 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=30554697&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 04, 2024 | B405281 | |
| Certificate of Analysis | Jun 04, 2024 | B405281 | |
| Certificate of Analysis | Jun 04, 2024 | B405281 |
| Melt Point(°C) | 110 °C |
|---|---|
| Molecular Weight | 436.100 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 435.905 Da |
| Monoisotopic Mass | 433.907 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 382.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |