Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B487024-100ml
|
100ml |
1
|
$207.90
|
|
| Synonyms | Bis(methacryloyloxyethyl) hydrogen phosphate |
|---|---|
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Bis[2-(methacryloyloxy)ethyl] phosphate (BMEP) is a hydrophilic monomer with two polymerizable methacrylate groups and a centrally placed phosphate group. In presence of an acid, it can undergo spontaneous polymerization with a high degree of conversion. It is widely used as a precursor in the synthesis of poly (BMEP), dental resins, hydrogels, and fire-retardant polymer composites. Application: Bis[2-(methacryloyloxy)ethyl] phosphate (BMEP) can be used: |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic phosphoric acids and derivatives |
| Subclass | Phosphate esters |
| Intermediate Tree Nodes | Alkyl phosphates |
| Direct Parent | Dialkyl phosphates |
| Alternative Parents | Dicarboxylic acids and derivatives Enoate esters Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dialkyl phosphate - Dicarboxylic acid or derivatives - Alpha,beta-unsaturated carboxylic ester - Enoate ester - Carboxylic acid ester - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkyl phosphates. These are organic compounds containing a phosphate group that is linked to exactly two alkyl chain. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphoryl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| INCHI | InChI=1S/C12H19O8P/c1-9(2)11(13)17-5-7-19-21(15,16)20-8-6-18-12(14)10(3)4/h1,3,5-8H2,2,4H3,(H,15,16) |
| InChIKey | NXBXJOWBDCQIHF-UHFFFAOYSA-N |
| Smiles | CC(=C)C(=O)OCCOP(=O)(O)OCCOC(=O)C(=C)C |
| Isomeric SMILES | CC(=C)C(=O)OCCOP(=O)(O)OCCOC(=O)C(=C)C |
| Molecular Weight | 322.25 |
| Reaxy-Rn | 8570304 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8570304&ln= |
| Refractive Index | n20/D 1.47 (lit.) |
|---|---|
| Flash Point(°F) | Not applicable |
| Flash Point(°C) | Not applicable |
| Boil Point(°C) | 221℃ (lit.) |
| Molecular Weight | 322.250 g/mol |
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 12 |
| Exact Mass | 322.082 Da |
| Monoisotopic Mass | 322.082 Da |
| Topological Polar Surface Area | 108.000 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 418.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Liwei Sun, Xu Zhang, Jiteng Zhang, Xinmeng Li, Jie Zhao, Rujian Jiang, Lingjie Song, Shifang Luan. (2024) Endogenous stimulation-driven Janus mesh with antibacterial, anti-adhesive and prohealing performances for hernia repair. CHEMICAL ENGINEERING JOURNAL, 494 (152764). |