Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B586624-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$243.90
|
|
| Synonyms | DTXSID60856646 | 4-Benzothiazolecarboxaldehyde | A920264 | 4-benzothiazolecarbaldehyde | 1213833-90-9 | Benzothiazole-4-carbaldehyde | SCHEMBL732122 | VCNWADMZUYTNIH-UHFFFAOYSA-N | MFCD22394756 | 1,3-benzothiazole-4-carbaldehyde | benzo[d]thiazole-4-carba |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzothiazoles |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzothiazoles |
| Alternative Parents | Aryl-aldehydes Benzenoids Thiazoles Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1,3-benzothiazole - Aryl-aldehyde - Benzenoid - Heteroaromatic compound - Thiazole - Azole - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aldehyde - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzothiazoles. These are organic compounds containing a benzene fused to a thiazole ring (a five-membered ring with four carbon atoms, one nitrogen atom and one sulfur atom). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,3-benzothiazole-4-carbaldehyde |
|---|---|
| INCHI | InChI=1S/C8H5NOS/c10-4-6-2-1-3-7-8(6)9-5-11-7/h1-5H |
| InChIKey | VCNWADMZUYTNIH-UHFFFAOYSA-N |
| Smiles | C1=CC(=C2C(=C1)SC=N2)C=O |
| Isomeric SMILES | C1=CC(=C2C(=C1)SC=N2)C=O |
| Alternate CAS | 1213833-90-9 |
| Molecular Weight | 163.19 |
| Reaxy-Rn | 38298796 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=38298796&ln= |
| Molecular Weight | 163.200 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 163.009 Da |
| Monoisotopic Mass | 163.009 Da |
| Topological Polar Surface Area | 58.200 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 162.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |