Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B170387-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$199.90
|
|
| Synonyms | 4435-67-0 | 1,3,5-Benzenetriacetic acid | Benzene-1,3,5-triacetic acid | 2,2',2''-(Benzene-1,3,5-triyl)triacetic acid | 2-[3,5-bis(carboxymethyl)phenyl]acetic acid | MFCD03095533 | 1,3,5-Tris(carboxymethyl)benzene | 1 3 5-BENZENETRIACETIC ACID | NSC408182 | 1,5-Benzenetria |
|---|---|
| Specifications & Purity | ≥97%(T) |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Tricarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tricarboxylic acids and derivatives |
| Alternative Parents | Benzene and substituted derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Tricarboxylic acid or derivatives - Benzenoid - Monocyclic benzene moiety - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as tricarboxylic acids and derivatives. These are carboxylic acids containing exactly three carboxyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-[3,5-bis(carboxymethyl)phenyl]acetic acid |
|---|---|
| INCHI | InChI=1S/C12H12O6/c13-10(14)4-7-1-8(5-11(15)16)3-9(2-7)6-12(17)18/h1-3H,4-6H2,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | AJEIBHNKBLRDNT-UHFFFAOYSA-N |
| Smiles | C1=C(C=C(C=C1CC(=O)O)CC(=O)O)CC(=O)O |
| Isomeric SMILES | C1=C(C=C(C=C1CC(=O)O)CC(=O)O)CC(=O)O |
| WGK Germany | 3 |
| Molecular Weight | 252.22 |
| Beilstein | 9300290 |
| Reaxy-Rn | 3099522 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3099522&ln= |
| Melt Point(°C) | 210 - 215 ℃ |
|---|---|
| Molecular Weight | 252.220 g/mol |
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 252.063 Da |
| Monoisotopic Mass | 252.063 Da |
| Topological Polar Surface Area | 112.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |