Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P108922-100ml
|
100ml |
6
|
$11.90
|
|
|
P108922-500ml
|
500ml |
2
|
$44.90
|
|
| Synonyms | (1S,5S)-pin-2(10)-ene | AFN153A7SU | CAS_87134-87-0 | DTXSID1041184 | (1)-6,6-Dimethyl-2-methylenebicyclo(3.1.1)heptane | (1S,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane | 1S,5S-(-)-beta-Pinene | (-)-beta-Pinene, analytical standard | (1S,5S)-2(10 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bicyclic monoterpenoids |
| Alternative Parents | Polycyclic hydrocarbons Branched unsaturated hydrocarbons Cyclic olefins Unsaturated aliphatic hydrocarbons |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Pinane monoterpenoid - Bicyclic monoterpenoid - Branched unsaturated hydrocarbon - Polycyclic hydrocarbon - Cyclic olefin - Unsaturated aliphatic hydrocarbon - Unsaturated hydrocarbon - Olefin - Hydrocarbon - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. |
| External Descriptors | Bicyclic monoterpenoids |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 488189770 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488189770 |
| IUPAC Name | (1S,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane |
| INCHI | InChI=1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | WTARULDDTDQWMU-IUCAKERBSA-N |
| Smiles | CC1(C2CCC(=C)C1C2)C |
| Isomeric SMILES | CC1([C@H]2CCC(=C)[C@@H]1C2)C |
| WGK Germany | 3 |
| UN Number | 3295 |
| Packing Group | II |
| Molecular Weight | 136.23 |
| Beilstein | 2038282 |
| Reaxy-Rn | 1362266 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1362266&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 09, 2023 | P108922 | |
| Certificate of Analysis | Aug 09, 2023 | P108922 | |
| Certificate of Analysis | Aug 09, 2023 | P108922 | |
| Certificate of Analysis | Nov 05, 2022 | P108922 | |
| Certificate of Analysis | Nov 05, 2022 | P108922 | |
| Certificate of Analysis | Nov 05, 2022 | P108922 | |
| Certificate of Analysis | Nov 05, 2022 | P108922 | |
| Certificate of Analysis | Nov 05, 2022 | P108922 |
| Solubility | Insoluble in water; Very soluble in Chloroform; Soluble in Benzene,Alcohol,Ether |
|---|---|
| Refractive Index | 1.477-1.481 |
| Specific Rotation[α] | -21 ° (neat) |
| Flash Point(°F) | 32℃ |
| Flash Point(°C) | 32℃ |
| Boil Point(°C) | 165 °C |
| Molecular Weight | 136.230 g/mol |
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 136.125 Da |
| Monoisotopic Mass | 136.125 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 176.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |