H2229023Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | SCHEMBL3634303 | Triethoxyarsine | Arsenic triethoxide | Triethoxyarsine, 97% | Arsenic ethoxide | Arsenic(Iii) Ethoxide | ?ARSENIC TRIETHOXIDE | EINECS 221-543-1 | Arsenous acid, triethyl ester | triethyl arsorite | Arsenious acid (H3AsO3), triethyl este |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
-
Superclass
Organometallic compounds
-
Class
Organometalloid compounds
- Subclass Organoarsenic compounds
-
Class
Organometalloid compounds
-
Superclass
Organometallic compounds
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organoarsenic compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trivalent organic arsenic compounds |
| Alternative Parents | Organic metalloid salts Organooxygen compounds Organic oxoanionic compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trivalent organic arsenic compound - Organic arsenite - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Organooxygen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trivalent organic arsenic compounds. These are organoarsenic compounds in which a carbon is linked to a trivalent arsenic atom. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| IUPAC Name | triethyl arsorite |
|---|---|
| INCHI | InChI=1S/C6H15AsO3/c1-4-8-7(9-5-2)10-6-3/h4-6H2,1-3H3 |
| InChIKey | BUZKVHDUZDJKHI-UHFFFAOYSA-N |
| Smiles | CCO[As](OCC)OCC |
| Isomeric SMILES | CCO[As](OCC)OCC |
| Molecular Weight | 210.11 |
| Reaxy-Rn | 1699059 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1699059&ln= |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Sensitivity | Moisture sensitive |
|---|---|
| Refractive Index | 1.433 |
| Boil Point(°C) | 162° C (lit.) at 745 mmHg |
| Molecular Weight | 210.100 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 6 |
| Exact Mass | 210.024 Da |
| Monoisotopic Mass | 210.024 Da |
| Topological Polar Surface Area | 27.700 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 55.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later