Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A422388-1ml
|
1ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$160.90
|
|
| Synonyms | AVex-73 hydrochloride | (+/-)-.DELTA.-HEXALACTONE | Blarcamesine hydrochloride [USAN] | AC-33187 | MFCD30146449 | SCHEMBL15938931 | EN300-20623 | AN2/AVex-73 hydrochloride salt | Q27252594 | 1-(2,2-diphenyloxolan-3-yl)-N,N-dimethylmethanamine;hydrochlorid |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Product Description: |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Diphenylmethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylmethanes |
| Alternative Parents | Aralkylamines Oxolanes Trialkylamines Oxacyclic compounds Dialkyl ethers Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Diphenylmethane - Aralkylamine - Oxolane - Tertiary amine - Tertiary aliphatic amine - Dialkyl ether - Ether - Oxacycle - Organoheterocyclic compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Amine - Organic nitrogen compound - Hydrochloride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as diphenylmethanes. These are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-(2,2-diphenyloxolan-3-yl)-N,N-dimethylmethanamine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C19H23NO.ClH/c1-20(2)15-18-13-14-21-19(18,16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-12,18H,13-15H2,1-2H3;1H |
| InChIKey | FEQOLYDPQKHFTD-UHFFFAOYSA-N |
| Smiles | CN(C)CC1CCOC1(C2=CC=CC=C2)C3=CC=CC=C3.Cl |
| Isomeric SMILES | CN(C)CC1CCOC1(C2=CC=CC=C2)C3=CC=CC=C3.Cl |
| Molecular Weight | 317.86 |
| Reaxy-Rn | 7501989 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=7501989&ln= |
| Molecular Weight | 317.900 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 317.155 Da |
| Monoisotopic Mass | 317.155 Da |
| Topological Polar Surface Area | 12.500 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 298.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |