Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A475187-250mg
|
250mg |
4
|
$201.90
|
|
|
A475187-1g
|
1g |
2
|
$667.90
|
|
| Synonyms | Diammonium hexachloroiridate | ammonium hexachloroiridate |
|---|---|
| Specifications & Purity | PrimorTrace™, ≥99.99% metals basis |
| Grade | PrimorTrace™ |
Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Class | Transition metal salts |
| Subclass | Transition metal chlorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Transition metal chlorides |
| Alternative Parents | Inorganic chloride salts |
| Molecular Framework | Not available |
| Substituents | Transition metal chloride - Inorganic chloride salt - Inorganic salt |
| Description | This compound belongs to the class of inorganic compounds known as transition metal chlorides. These are inorganic compounds in which the largest halogen atom is Chlorine, and the heaviest metal atom is a transition metal. |
| External Descriptors | ammonium salt |
|
|
|
| Pubchem Sid | 504768110 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768110 |
| IUPAC Name | diazanium;hexachloroiridium(2-) |
| INCHI | InChI=1S/6ClH.Ir.2H3N/h6*1H;;2*1H3/q;;;;;;+4;;/p-4 |
| InChIKey | LWNOUTCTZQNGEN-UHFFFAOYSA-J |
| Smiles | [NH4+].[NH4+].Cl[Ir-2](Cl)(Cl)(Cl)(Cl)Cl |
| Isomeric SMILES | [NH4+].[NH4+].Cl[Ir-2](Cl)(Cl)(Cl)(Cl)Cl |
| WGK Germany | 3 |
| RTECS | BP5295000 |
| PubChem CID | 16211476 |
| Molecular Weight | 441.01 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 24, 2025 | A475187 | |
| Certificate of Analysis | May 24, 2025 | A475187 | |
| Certificate of Analysis | Aug 09, 2024 | A475187 | |
| Certificate of Analysis | Aug 09, 2024 | A475187 | |
| Certificate of Analysis | Mar 29, 2023 | A475187 | |
| Certificate of Analysis | Mar 29, 2023 | A475187 | |
| Certificate of Analysis | Mar 01, 2023 | A475187 | |
| Certificate of Analysis | Mar 01, 2023 | A475187 |
| Solubility | Soluble in water |
|---|---|
| Sensitivity | Moisture sensitive |
| Molecular Weight | 441.000 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 440.842 Da |
| Monoisotopic Mass | 438.845 Da |
| Topological Polar Surface Area | 2.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 62.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
Starting at $159.90
| 1. Ling Zhang, Jikai Sun, Shuchao Jiang, Huijie He, Guoqing Ren, Dong Zhai, Rui Tu, Shengliang Zhai, Tie Yu. (2022) Synergetic effect between Pd2+ and Ir4+ species promoting direct ethane dehydrogenation into ethylene over bimetallic PdIr/AC catalysts. Catalysis Science & Technology, 12 (12): (3874-3885). |
| 2. Shanyong Chen, Shiyan Wang, Panpan Hao, Muhong Li, Yu Zhang, Jia Guo, Weiping Ding, Min Liu, Jinlan Wang, Xuefeng Guo. (2022) N,O-C Nanocage-mediated high-efficient hydrogen evolution reaction on IrNi@N,O-C electrocatalyst. APPLIED CATALYSIS B-ENVIRONMENTAL, 304 (120996). |
| 3. Xiaoyue Wan, Qi Zhang, Mingming Zhu, Yi Zhao, Yongmei Liu, Chunmei Zhou, Yanhui Yang, Yong Cao. (2019) Interface synergy between IrOx and H-ZSM-5 in selective C–O hydrogenolysis of glycerol toward 1,3-propanediol. JOURNAL OF CATALYSIS, 375 (339). |
| 4. Wu Lian-Kui, Shi Yi-Jie, Su Cheng, Cao Hua-Zhen, Zheng Guo-Qu. (2019) Efficient Electrochemical Reduction of High Concentration Nitrate by a Stepwise Method. CATALYSIS LETTERS, 149 (5): (1216-1223). |
| 5. Hang Cheong Chan, Ting Chen, Lifang Xie, Yijin Shu, Qingsheng Gao. (2018) Enhancing formaldehyde oxidation on iridium catalysts using hydrogenated TiO2 supports. NEW JOURNAL OF CHEMISTRY, 42 (22): (18381-18387). |
| 6. Jiahao Yang, Zhaoping Shi, Yibo Wang, Hongxiang Wu, Jing Ni, Pengbo Wang, Meiling Xiao, Changpeng Liu, Wei Xing. (2025) Ultrastable Ti@Ir core-shell catalyst with low iridium loading for water electrolysis at industrial-level current density. CHEMICAL ENGINEERING JOURNAL, 506 (160118). |