L2129082Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | MFCD00015011 | PhAc azine | A837678 | Ethanone, 1-phenyl-, azine | AS-10685 | Ethanone,1-phenyl-,2-(1-phenylethylidene)hydrazone | SR-01000631677-1 | Acetophenone, azine | Acetophenone-, azine | 1-phenyl-N-[(E)-1-phenylethylideneamino]ethanimine | Ethanon |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
-
Superclass
Organic nitrogen compounds
-
Class
Organonitrogen compounds
- Subclass Hydrazines and derivatives
-
Class
Organonitrogen compounds
-
Superclass
Organic nitrogen compounds
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Hydrazines and derivatives |
| Intermediate Tree Nodes | Azines |
| Direct Parent | Ketazines |
| Alternative Parents | Benzene and substituted derivatives Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Ketazine - Benzenoid - Monocyclic benzene moiety - Organopnictogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as ketazines. These are azines of ketones containing a moiety with the formula R2C=NN=CR2. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| Pubchem Sid | 488195574 |
|---|---|
| IUPAC Name | (E)-1-phenyl-N-[(E)-1-phenylethylideneamino]ethanimine |
| INCHI | InChI=1S/C16H16N2/c1-13(15-9-5-3-6-10-15)17-18-14(2)16-11-7-4-8-12-16/h3-12H,1-2H3/b17-13+,18-14+ |
| InChIKey | MOKMQSIJAHPSQX-HBKJEHTGSA-N |
| Smiles | CC(=NN=C(C)C1=CC=CC=C1)C2=CC=CC=C2 |
| Isomeric SMILES | C/C(=N\N=C(\C1=CC=CC=C1)/C)/C2=CC=CC=C2 |
| Molecular Weight | 236.32 |
| Reaxy-Rn | 745624 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=745624&ln= |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Melt Point(°C) | 120-124 ℃ |
|---|---|
| Molecular Weight | 236.310 g/mol |
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 236.131 Da |
| Monoisotopic Mass | 236.131 Da |
| Topological Polar Surface Area | 24.700 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 2 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 2 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later