Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E156447-250mg
|
250mg |
2
|
$39.90
|
|
|
E156447-1g
|
1g |
2
|
$97.90
|
|
| Synonyms | 9-Ethyl-3-(N-methyl-N-phenylhydrazonomethyl)carbazole | N-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]-N-methylaniline | 9-Ethyl-3-carbazolecarboxaldehyde-N-methyl-N-phenylhydrazone, 98% | 9-Ethyl-3-((2-methyl-2-phenylhydrazono)methyl)-9H-carbazole | 9-et |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Indoles and derivatives |
| Subclass | Carbazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carbazoles |
| Alternative Parents | N-alkylindoles Indoles Phenylhydrazines Substituted pyrroles Heteroaromatic compounds Hydrazones Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Carbazole - N-alkylindole - Indole - Phenylhydrazine - Benzenoid - Substituted pyrrole - Monocyclic benzene moiety - Heteroaromatic compound - Pyrrole - Azacycle - Hydrazone - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as carbazoles. These are compounds containing a three ring system containing a pyrrole ring fused on either side to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504764840 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764840 |
| IUPAC Name | N-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]-N-methylaniline |
| INCHI | InChI=1S/C22H21N3/c1-3-25-21-12-8-7-11-19(21)20-15-17(13-14-22(20)25)16-23-24(2)18-9-5-4-6-10-18/h4-16H,3H2,1-2H3/b23-16+ |
| InChIKey | QYXUHIZLHNDFJT-XQNSMLJCSA-N |
| Smiles | CCN1C2=C(C=C(C=C2)C=NN(C)C3=CC=CC=C3)C4=CC=CC=C41 |
| Isomeric SMILES | CCN1C2=C(C=C(C=C2)/C=N/N(C)C3=CC=CC=C3)C4=CC=CC=C41 |
| Molecular Weight | 327.43 |
| Reaxy-Rn | 5607802 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5607802&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 29, 2024 | E156447 | |
| Certificate of Analysis | Jan 29, 2024 | E156447 | |
| Certificate of Analysis | Jan 29, 2024 | E156447 | |
| Certificate of Analysis | Jan 29, 2024 | E156447 |
| Solubility | Soluble in Toluene |
|---|---|
| Sensitivity | Air Sensitive |
| Melt Point(°C) | 129°C(lit.) |
| Molecular Weight | 327.400 g/mol |
| XLogP3 | 5.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 327.174 Da |
| Monoisotopic Mass | 327.174 Da |
| Topological Polar Surface Area | 20.500 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 456.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |