Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C170093-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,687.90
|
|
| Synonyms | 8-chloro-2-ethylimidazo[1,2-a]pyrazine | 391954-17-9 | 8-Chloro-2-ethylimidazol[1,2-a]pyrazine | MFCD10699213 | SCHEMBL2871017 | DTXSID30477044 | VLICETQWBPEXNS-UHFFFAOYSA-N | AKOS006303922 | PB22432 | AS-50736 | SY318835 | CS-0054700 | FT-0685153 | P10988 | J-519417 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Imidazopyrazines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazopyrazines |
| Alternative Parents | Pyrazines N-substituted imidazoles Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazopyrazine - Pyrazine - N-substituted imidazole - Aryl halide - Aryl chloride - Heteroaromatic compound - Imidazole - Azole - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as imidazopyrazines. These are organic heteropolycyclic compounds containing a pyrazine ring fused to an imidazole ring. These also include hydrogenated derivatives of the imidazopyrazine moiety. Imidazole is 5-membered ring consisting of three carbon atoms, and two nitrogen centers at the 1- and 3-positions. Pyrazine is a 6-membered ring consisting of six carbon atoms and two nitrogen centers at ring positions 1 and 4. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 8-chloro-2-ethylimidazo[1,2-a]pyrazine |
|---|---|
| INCHI | InChI=1S/C8H8ClN3/c1-2-6-5-12-4-3-10-7(9)8(12)11-6/h3-5H,2H2,1H3 |
| InChIKey | VLICETQWBPEXNS-UHFFFAOYSA-N |
| Smiles | CCC1=CN2C=CN=C(C2=N1)Cl |
| Isomeric SMILES | CCC1=CN2C=CN=C(C2=N1)Cl |
| Molecular Weight | 181.62 |
| Reaxy-Rn | 13904706 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=13904706&ln= |
| Molecular Weight | 181.620 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 181.041 Da |
| Monoisotopic Mass | 181.041 Da |
| Topological Polar Surface Area | 30.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 164.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |