Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B175301-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$176.90
|
|
| Synonyms | 186519-89-1 | 4-CHLORO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE | 4-CHLORO-7-PHENYLSULFONYL-7H-PYRROLO[2,3-D]PYRIMIDINE | 7-(benzenesulfonyl)-4-chloro-7H-pyrrolo[2,3-d]pyrimidine | 7-(BENZENESULFONYL)-4-CHLOROPYRROLO[2,3-D]PYRIMIDINE | MFCD09909367 | HPWMGRLPNP |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonamides |
| Alternative Parents | Pyrrolo[2,3-d]pyrimidines Benzenesulfonyl compounds Halopyrimidines Substituted pyrroles Aryl chlorides Sulfonyls Organosulfonic acids and derivatives Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzenesulfonamide - Pyrrolo[2,3-d]pyrimidine - Benzenesulfonyl group - Pyrrolopyrimidine - Halopyrimidine - Aryl chloride - Aryl halide - Pyrimidine - Substituted pyrrole - Heteroaromatic compound - Pyrrole - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organosulfur compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonamides. These are organic compounds containing a sulfonamide group that is S-linked to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 7-(benzenesulfonyl)-4-chloropyrrolo[2,3-d]pyrimidine |
|---|---|
| INCHI | InChI=1S/C12H8ClN3O2S/c13-11-10-6-7-16(12(10)15-8-14-11)19(17,18)9-4-2-1-3-5-9/h1-8H |
| InChIKey | HPWMGRLPNPQCQX-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=CN=C3Cl |
| Isomeric SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=CN=C3Cl |
| Molecular Weight | 293.729 |
| Reaxy-Rn | 8066496 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8066496&ln= |
| Molecular Weight | 293.730 g/mol |
|---|---|
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 293.003 Da |
| Monoisotopic Mass | 293.003 Da |
| Topological Polar Surface Area | 73.200 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 419.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |