Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A174905-250mg
|
250mg |
3
|
$70.90
|
|
|
A174905-1g
|
1g |
2
|
$234.90
|
|
| Synonyms | 7-aminoisoindolin-1-one | 169044-98-8 | 7-AMINO-2,3-DIHYDRO-1H-ISOINDOL-1-ONE | 7-AMINO-2,3-DIHYDROISOINDOL-1-ONE | 7-AMINOISOINDOLINONE | MFCD09396704 | 1H-ISOINDOL-1-ONE, 7-AMINO-2,3-DIHYDRO- | 7-Amino-1-isoindolinone | SCHEMBL1585047 | DTXSID30585552 | ZPJBSWJZELXZKA-UHFF |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Isoindoles and derivatives |
| Subclass | Isoindolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isoindolones |
| Alternative Parents | Isoindoles Benzenoids Vinylogous amides Secondary carboxylic acid amides Lactams Amino acids and derivatives Azacyclic compounds Primary amines Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isoindolone - Isoindole - Benzenoid - Vinylogous amide - Amino acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Lactam - Carboxylic acid derivative - Azacycle - Amine - Organooxygen compound - Organonitrogen compound - Primary amine - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as isoindolones. These are aromatic polycyclic compounds that an isoindole bearing a ketone. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 7-amino-2,3-dihydroisoindol-1-one |
|---|---|
| INCHI | InChI=1S/C8H8N2O/c9-6-3-1-2-5-4-10-8(11)7(5)6/h1-3H,4,9H2,(H,10,11) |
| InChIKey | ZPJBSWJZELXZKA-UHFFFAOYSA-N |
| Smiles | C1C2=C(C(=CC=C2)N)C(=O)N1 |
| Isomeric SMILES | C1C2=C(C(=CC=C2)N)C(=O)N1 |
| Molecular Weight | 148.165 |
| Reaxy-Rn | 14521345 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14521345&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 07, 2025 | A174905 | |
| Certificate of Analysis | Sep 04, 2023 | A174905 | |
| Certificate of Analysis | Sep 04, 2023 | A174905 |
| Sensitivity | moisture sensitive |
|---|---|
| Molecular Weight | 148.160 g/mol |
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 148.064 Da |
| Monoisotopic Mass | 148.064 Da |
| Topological Polar Surface Area | 55.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 181.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |