Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F179086-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$587.90
|
|
|
F179086-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,559.90
|
|
Discover 6-Fluoro-8-trifluoromethylquinoline by Aladdin Scientific in 98% for only $587.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | SB70104 | 1065074-24-9 | BS-23437 | 6-FLUORO-8-TRIFLUOROMETHYLQUINOLINE | 6-Fluoro-8-(trifluoromethyl)quinoline | AKOS015853393 | DTXSID80674728 | MFCD11504882 | SCHEMBL22270813 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Haloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Haloquinolines |
| Alternative Parents | Pyridines and derivatives Benzenoids Aryl fluorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Haloquinoline - Benzenoid - Pyridine - Aryl halide - Aryl fluoride - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as haloquinolines. These are compounds containing a quinoline moiety, which is substituted at one or more ring positions by n halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-fluoro-8-(trifluoromethyl)quinoline |
|---|---|
| INCHI | InChI=1S/C10H5F4N/c11-7-4-6-2-1-3-15-9(6)8(5-7)10(12,13)14/h1-5H |
| InChIKey | YABAVCVZUGPWSZ-UHFFFAOYSA-N |
| Smiles | C1=CC2=CC(=CC(=C2N=C1)C(F)(F)F)F |
| Isomeric SMILES | C1=CC2=CC(=CC(=C2N=C1)C(F)(F)F)F |
| PubChem CID | 46739095 |
| Molecular Weight | 215.1 |
| Molecular Weight | 215.150 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 215.036 Da |
| Monoisotopic Mass | 215.036 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 228.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |