Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F173561-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$6,771.90
|
|
Discover 6-fluoro-1H-indazol-5-ol by Aladdin Scientific in 97% for only $6,771.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 6-Fluoro-1H-indazol-5-ol | 1360884-19-0 | 1h-indazol-5-ol,6-fluoro- | SCHEMBL18345083 | AKOS030628643 | SB16391 | AS-53164 | CS-0050209 | EN300-733240 | P16150 | Z1939440102 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrazoles |
| Subclass | Indazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indazoles |
| Alternative Parents | O-fluorophenols 1-hydroxy-2-unsubstituted benzenoids Aryl fluorides Pyrazoles Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzopyrazole - Indazole - 2-halophenol - 2-fluorophenol - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Aryl fluoride - Aryl halide - Benzenoid - Azole - Heteroaromatic compound - Pyrazole - Azacycle - Organofluoride - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxygen compound - Organic nitrogen compound - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as indazoles. These are compounds containing an indazole, which is structurally characterized by a pyrazole fused to a benzene. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-fluoro-1H-indazol-5-ol |
|---|---|
| INCHI | InChI=1S/C7H5FN2O/c8-5-2-6-4(1-7(5)11)3-9-10-6/h1-3,11H,(H,9,10) |
| InChIKey | XDJJDOKXCSVOFZ-UHFFFAOYSA-N |
| Smiles | C1=C2C=NNC2=CC(=C1O)F |
| Isomeric SMILES | C1=C2C=NNC2=CC(=C1O)F |
| Molecular Weight | 152.128 |
| Reaxy-Rn | 31076192 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=31076192&ln= |
| Molecular Weight | 152.130 g/mol |
|---|---|
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 152.039 Da |
| Monoisotopic Mass | 152.039 Da |
| Topological Polar Surface Area | 48.900 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 155.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |