Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E167754-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
| Synonyms | 16489-90-0 | 6-ethoxy-2,2,4-trimethyl-1,2,3,4-tetrahydroquinoline | 6-Ethoxy-1,2,3,4-tetrahydro-2,2,4-trimethylquinoline | Quinoline, 6-ethoxy-1,2,3,4-tetrahydro-2,2,4-trimethyl- | 6-ethoxy-2,2,4-trimethyl-3,4-dihydro-1H-quinoline | 6-Ethoxy-2,3,4-trimethyl-1,2,3,4 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Hydroquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hydroquinolines |
| Alternative Parents | Secondary alkylarylamines Aralkylamines Alkyl aryl ethers Benzenoids Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Tetrahydroquinoline - Alkyl aryl ether - Secondary aliphatic/aromatic amine - Aralkylamine - Benzenoid - Ether - Secondary amine - Azacycle - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Amine - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as hydroquinolines. These are derivatives of quinoline in which in which at least one double bond in the quinoline moiety are reduced by adding two hydrogen atoms. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 6-ethoxy-2,2,4-trimethyl-3,4-dihydro-1H-quinoline |
|---|---|
| INCHI | InChI=1S/C14H21NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-8,10,15H,5,9H2,1-4H3 |
| InChIKey | YLDDCEXDGNXCIO-UHFFFAOYSA-N |
| Smiles | CCOC1=CC2=C(C=C1)NC(CC2C)(C)C |
| Isomeric SMILES | CCOC1=CC2=C(C=C1)NC(CC2C)(C)C |
| Molecular Weight | 219.33 |
| Reaxy-Rn | 159986 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=159986&ln= |
| Molecular Weight | 219.320 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 219.162 Da |
| Monoisotopic Mass | 219.162 Da |
| Topological Polar Surface Area | 21.300 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 239.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |