Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C171711-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$453.90
|
|
Discover (6-chloropyrimidin-4-yl)methanol by Aladdin Scientific in 97% for only $453.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | (6-CHLOROPYRIMIDIN-4-YL)METHANOL | 1025351-41-0 | 6-CHLORO-4-HYDROXYMETHYLPYRIMIDINE | 4-Pyrimidinemethanol, 6-chloro- | MFCD20482236 | 6-Chloropyrimidine-4-methanol | SCHEMBL1660131 | (6-chloropyrimidin-4-yl)metanol | DTXSID60857193 | (6-chloro-4-pyrimidinyl)methanol | BODR |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Halopyrimidines |
| Alternative Parents | Aryl chlorides Heteroaromatic compounds Azacyclic compounds Primary alcohols Organonitrogen compounds Organochlorides Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Halopyrimidine - Aryl chloride - Aryl halide - Heteroaromatic compound - Azacycle - Aromatic alcohol - Primary alcohol - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organic oxygen compound - Organic nitrogen compound - Alcohol - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as halopyrimidines. These are aromatic compounds containing a halogen atom linked to a pyrimidine ring. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (6-chloropyrimidin-4-yl)methanol |
|---|---|
| INCHI | InChI=1S/C5H5ClN2O/c6-5-1-4(2-9)7-3-8-5/h1,3,9H,2H2 |
| InChIKey | BODRLAXXPQWIQM-UHFFFAOYSA-N |
| Smiles | C1=C(N=CN=C1Cl)CO |
| Isomeric SMILES | C1=C(N=CN=C1Cl)CO |
| Molecular Weight | 144.56 |
| Reaxy-Rn | 18593735 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18593735&ln= |
| Molecular Weight | 144.560 g/mol |
|---|---|
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 144.009 Da |
| Monoisotopic Mass | 144.009 Da |
| Topological Polar Surface Area | 46.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 91.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |