Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B635616-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$271.90
|
|
| Synonyms | 6-bromo-8-iodo-2-methylimidazo[1,2-a]pyridine | 1421601-69-5 | 6-bromo-8-iodo-2-methyl-imidazo[1,2-a]pyridine | MFCD22391931 | SCHEMBL24387034 | AKOS026728844 | AS-79132 | SY251311 | EN300-105782 | P19434 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Imidazopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazopyridines |
| Alternative Parents | Imidazo[1,2-a]pyridines Polyhalopyridines Dihydropyridines Heteroaromatic compounds Azoles Vinyl iodides Vinyl bromides Propargyl-type 1,3-dipolar organic compounds Iodoalkenes Carboximidamides Bromoalkenes Azacyclic compounds Amidines Organopnictogen compounds Organoiodides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazo[1,2-a]pyridine - Imidazopyridine - Polyhalopyridine - Dihydropyridine - Pyridine - Heteroaromatic compound - Azole - Azacycle - Iodoalkene - Bromoalkene - Haloalkene - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboximidamide - Vinyl iodide - Vinyl halide - Vinyl bromide - Amidine - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organoiodide - Organobromide - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as imidazopyridines. These are organic polycyclic compounds containing an imidazole ring fused to a pyridine ring. Imidazole is 5-membered ring consisting of three carbon atoms, and two nitrogen centers at the 1- and 3-positions. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-bromo-8-iodo-2-methylimidazo[1,2-a]pyridine |
|---|---|
| INCHI | InChI=1S/C8H6BrIN2/c1-5-3-12-4-6(9)2-7(10)8(12)11-5/h2-4H,1H3 |
| InChIKey | ZTPQJTYRQYARJK-UHFFFAOYSA-N |
| Smiles | CC1=CN2C=C(C=C(C2=N1)I)Br |
| Isomeric SMILES | CC1=CN2C=C(C=C(C2=N1)I)Br |
| PubChem CID | 71755923 |
| Molecular Weight | 336.95 |
| Molecular Weight | 336.950 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 335.876 Da |
| Monoisotopic Mass | 335.876 Da |
| Topological Polar Surface Area | 17.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 178.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |