Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B586828-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$667.90
|
|
| Synonyms | 6-bromo-7-fluoro-3,4-dihydro-2H-naphthalen-1-one | BS-14830 | FXBNSHLDYXJLEZ-UHFFFAOYSA-N | SY273543 | SCHEMBL16858594 | 1260014-69-4 | 6-bromo-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-one | MFCD18208386 | 6-bromo-7-fluoro-3,4-dihydronaphthalen-1(2H)-one | |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Desiccated |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Tetralins |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetralins |
| Alternative Parents | Aryl alkyl ketones Alpha-branched alpha,beta-unsaturated ketones Enones Acryloyl compounds Vinyl fluorides Vinyl bromides Fluoroalkenes Bromoalkenes Organofluorides Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Tetralin - Aryl alkyl ketone - Aryl ketone - Alpha-branched alpha,beta-unsaturated-ketone - Alpha,beta-unsaturated ketone - Enone - Acryloyl-group - Ketone - Fluoroalkene - Bromoalkene - Haloalkene - Vinyl halide - Vinyl fluoride - Vinyl bromide - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organofluoride - Organobromide - Organohalogen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetralins. These are polycyclic aromatic compounds containing a tetralin moiety, which consists of a benzene fused to a cyclohexane. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-bromo-7-fluoro-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| INCHI | InChI=1S/C10H8BrFO/c11-8-4-6-2-1-3-10(13)7(6)5-9(8)12/h4-5H,1-3H2 |
| InChIKey | FXBNSHLDYXJLEZ-UHFFFAOYSA-N |
| Smiles | C1CC2=CC(=C(C=C2C(=O)C1)F)Br |
| Isomeric SMILES | C1CC2=CC(=C(C=C2C(=O)C1)F)Br |
| Molecular Weight | 243.07 |
| Reaxy-Rn | 28288395 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=28288395&ln= |
| Molecular Weight | 243.070 g/mol |
|---|---|
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 241.974 Da |
| Monoisotopic Mass | 241.974 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 219.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |