Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B166138-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$299.90
|
|
| Synonyms | 6-Bromo-4-chloro-2,8-dimethylquinoline, AldrichCPR | SCHEMBL17502184 | EN300-83968 | AKOS009865827 | 1153002-90-4 | DTXSID30656296 | 6-Bromo-4-chloro-2,8-dimethylquinoline | SB68730 | MFCD12114952 | Quinoline, 6-bromo-4-chloro-2,8-dimethyl- |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Haloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chloroquinolines |
| Alternative Parents | Methylpyridines Benzenoids Aryl chlorides Aryl bromides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chloroquinoline - Methylpyridine - Aryl bromide - Aryl chloride - Aryl halide - Pyridine - Benzenoid - Heteroaromatic compound - Azacycle - Organonitrogen compound - Organochloride - Organobromide - Organohalogen compound - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chloroquinolines. These are compounds containing a quinoline moiety, which carries one or more chlorine atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-bromo-4-chloro-2,8-dimethylquinoline |
|---|---|
| INCHI | InChI=1S/C11H9BrClN/c1-6-3-8(12)5-9-10(13)4-7(2)14-11(6)9/h3-5H,1-2H3 |
| InChIKey | YJTIVPXNBMXIJP-UHFFFAOYSA-N |
| Smiles | CC1=CC(=CC2=C(C=C(N=C12)C)Cl)Br |
| Isomeric SMILES | CC1=CC(=CC2=C(C=C(N=C12)C)Cl)Br |
| WGK Germany | 3 |
| Molecular Weight | 270.55 |
| Reaxy-Rn | 29204834 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=29204834&ln= |
| Molecular Weight | 270.550 g/mol |
|---|---|
| XLogP3 | 4.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 268.961 Da |
| Monoisotopic Mass | 268.961 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 211.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |