Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A178508-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$4,355.90
|
|
| Synonyms | 955028-68-9 | 6-AZASPIRO[2.5]OCTAN-4-OL HYDROCHLORIDE | 6-AZASPIRO[2.5]OCTAN-4-OL HCL | 6-azaspiro[2.5]octan-8-ol;hydrochloride | MFCD21607169 | SCHEMBL736327 | DTXSID70735771 | BKVWWBSIILYIBZ-UHFFFAOYSA-N | AKOS024015504 | PB21076 | PB35894 | SB20652 | AS-36216 | SY033105 | CS-0050 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidines |
| Alternative Parents | Secondary alcohols 1,2-aminoalcohols Dialkylamines Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Piperidine - Secondary alcohol - 1,2-aminoalcohol - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Hydrochloride - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidines. These are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-azaspiro[2.5]octan-8-ol;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H13NO.ClH/c9-6-5-8-4-3-7(6)1-2-7;/h6,8-9H,1-5H2;1H |
| InChIKey | BKVWWBSIILYIBZ-UHFFFAOYSA-N |
| Smiles | C1CC12CCNCC2O.Cl |
| Isomeric SMILES | C1CC12CCNCC2O.Cl |
| Molecular Weight | 163.65 |
| Reaxy-Rn | 45677748 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=45677748&ln= |
| Molecular Weight | 163.640 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 163.076 Da |
| Monoisotopic Mass | 163.076 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 120.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |