Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A178589-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$339.90
|
|
| Synonyms | 6-aminopyridazine-3-carboxamide | 98021-37-5 | MFCD16688837 | 3-Pyridazinecarboxamide, 6-amino- | SCHEMBL3153355 | 3-pyridazinecarboxamide,6-amino- | AMY33957 | YDA02137 | AKOS011436552 | SB11453 | AS-33966 | SY042166 | CS-0050340 | EN300-112454 | Z959893238 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid amides |
| Direct Parent | 2-heteroaryl carboxamides |
| Alternative Parents | Aminopyridazines Imidolactams Heteroaromatic compounds Primary carboxylic acid amides Amino acids and derivatives Azacyclic compounds Primary amines Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-heteroaryl carboxamide - Aminopyridazine - Pyridazine - Imidolactam - Heteroaromatic compound - Amino acid or derivatives - Primary carboxylic acid amide - Azacycle - Organoheterocyclic compound - Amine - Hydrocarbon derivative - Organic oxide - Primary amine - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-heteroaryl carboxamides. These are compounds containing a heteroaromatic ring that carries a carboxamide group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-aminopyridazine-3-carboxamide |
|---|---|
| INCHI | InChI=1S/C5H6N4O/c6-4-2-1-3(5(7)10)8-9-4/h1-2H,(H2,6,9)(H2,7,10) |
| InChIKey | PUXBHAXHLAOGOT-UHFFFAOYSA-N |
| Smiles | C1=CC(=NN=C1C(=O)N)N |
| Isomeric SMILES | C1=CC(=NN=C1C(=O)N)N |
| Molecular Weight | 138.13 |
| Reaxy-Rn | 120647 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=120647&ln= |
| Molecular Weight | 138.130 g/mol |
|---|---|
| XLogP3 | -1.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 138.054 Da |
| Monoisotopic Mass | 138.054 Da |
| Topological Polar Surface Area | 94.900 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |