Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D634646-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$278.90
|
|
|
D634646-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$445.90
|
|
|
D634646-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$743.90
|
|
|
D634646-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,339.90
|
|
| Synonyms | 845782-63-0 | 6,7-difluoroquinoxaline-2-carboxylic acid | 2-Quinoxalinecarboxylic acid, 6,7-difluoro- | 6,7-Difluoroquinoxaline-2-carboxylicacid | SCHEMBL6386976 | MFCD24496537 | PB43537 | AS-79772 | P19550 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinoxalines |
| Alternative Parents | Pyrazine carboxylic acids Benzenoids Aryl fluorides Heteroaromatic compounds Carboxylic acids Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinoxaline - Pyrazine carboxylic acid - Pyrazine carboxylic acid or derivatives - Aryl fluoride - Aryl halide - Pyrazine - Benzenoid - Heteroaromatic compound - Carboxylic acid - Carboxylic acid derivative - Azacycle - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as quinoxalines. These are compounds containing a quinoxaline moiety, a bicyclic heterocycle made up of a benzene ring fused to a pyrazine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6,7-difluoroquinoxaline-2-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C9H4F2N2O2/c10-4-1-6-7(2-5(4)11)13-8(3-12-6)9(14)15/h1-3H,(H,14,15) |
| InChIKey | GCQKGMKCGQJAAZ-UHFFFAOYSA-N |
| Smiles | C1=C2C(=CC(=C1F)F)N=C(C=N2)C(=O)O |
| Isomeric SMILES | C1=C2C(=CC(=C1F)F)N=C(C=N2)C(=O)O |
| PubChem CID | 69762228 |
| Molecular Weight | 210.14 |
| Molecular Weight | 210.140 g/mol |
|---|---|
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 210.024 Da |
| Monoisotopic Mass | 210.024 Da |
| Topological Polar Surface Area | 63.100 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |