Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F169524-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$302.90
|
|
| Synonyms | 31755-80-3 | 6-(4-Fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carbonitrile | 6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carbonitrile | 6-(4-fluorophenyl)-2-oxo-1,2-dihydro-3-pyridinecarbonitrile | 6-(4-Fluorophenyl)-1,2-dihydro-2-oxopyridine-3-carbonitrile | 6-(4-fluorop |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Phenylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyridines |
| Alternative Parents | 3-pyridinecarbonitriles Pyridinones Fluorobenzenes Dihydropyridines Aryl fluorides Heteroaromatic compounds Lactams Nitriles Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-phenylpyridine - 3-pyridinecarbonitrile - Dihydropyridine - Fluorobenzene - Halobenzene - Pyridinone - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Hydropyridine - Heteroaromatic compound - Lactam - Azacycle - Carbonitrile - Nitrile - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organohalogen compound - Organofluoride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyridines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| INCHI | InChI=1S/C12H7FN2O/c13-10-4-1-8(2-5-10)11-6-3-9(7-14)12(16)15-11/h1-6H,(H,15,16) |
| InChIKey | PYJGVVJYSZCUCO-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1C2=CC=C(C(=O)N2)C#N)F |
| Isomeric SMILES | C1=CC(=CC=C1C2=CC=C(C(=O)N2)C#N)F |
| Molecular Weight | 214.2 |
| Reaxy-Rn | 397688 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=397688&ln= |
| Molecular Weight | 214.190 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 214.054 Da |
| Monoisotopic Mass | 214.054 Da |
| Topological Polar Surface Area | 52.900 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 408.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |