Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T166843-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$104.90
|
|
Discover 5-(Trifluoromethyl)pyridine-2-carbonyl chloride by Aladdin Scientific in 97% for only $104.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | A889095 | STL554731 | 5-(Trifluoromethyl)pyridine-2-carbonyl chloride, 97% | SCHEMBL9779781 | MFCD11226644 | 5-Trifluoromethyl-pyridine-2-carbonyl chloride | BBL100937 | 2-Pyridinecarbonyl chloride, 5-(trifluoromethyl)- (9CI) | DTXSID40653377 | 5-(Trifluo |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Pyridinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridinecarboxylic acids and derivatives |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Acyl chlorides Organooxygen compounds Organonitrogen compounds Organofluorides Organochlorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine carboxylic acid or derivatives - Heteroaromatic compound - Acyl chloride - Acyl halide - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridinecarboxylic acids and derivatives. These are compounds containing a pyridine ring bearing a carboxylic acid group or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-(trifluoromethyl)pyridine-2-carbonyl chloride |
|---|---|
| INCHI | InChI=1S/C7H3ClF3NO/c8-6(13)5-2-1-4(3-12-5)7(9,10)11/h1-3H |
| InChIKey | XGGHEBGOZWCTKF-UHFFFAOYSA-N |
| Smiles | C1=CC(=NC=C1C(F)(F)F)C(=O)Cl |
| Isomeric SMILES | C1=CC(=NC=C1C(F)(F)F)C(=O)Cl |
| WGK Germany | 3 |
| PubChem CID | 37859655 |
| Molecular Weight | 209.55 |
| Flash Point(°F) | >230 °F |
|---|---|
| Flash Point(°C) | >110 °C |
| Molecular Weight | 209.550 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 208.986 Da |
| Monoisotopic Mass | 208.986 Da |
| Topological Polar Surface Area | 30.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 206.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |