Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N134528-1g
|
1g |
3
|
$65.90
|
|
|
N134528-5g
|
5g |
3
|
$195.90
|
|
| Synonyms | FT-0694858 | 2,2-di-hydroxymethyl-norborn-5-ene | 2,2-bishydroxymethyl-5-norbornene | 5-Norbornene-2,2-dimethanol | Bicyclo[2.2.1]hept-5-ene-2,2-diyldimethanol | Bicyclo[2.2.1]hept-5-ene-2,2-dimethanol | DTXSID30884330 | [2-(hydroxymethyl)-2-bicyclo[2.2.1 |
|---|---|
| Specifications & Purity | ≥95%(GC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Primary alcohols |
| Alternative Parents | Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Hydrocarbon derivative - Primary alcohol - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as primary alcohols. These are compounds comprising the primary alcohol functional group, with the general structure RCOH (R=alkyl, aryl). |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488187453 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488187453 |
| IUPAC Name | [2-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| INCHI | InChI=1S/C9H14O2/c10-5-9(6-11)4-7-1-2-8(9)3-7/h1-2,7-8,10-11H,3-6H2 |
| InChIKey | DSHXMENPUICESR-UHFFFAOYSA-N |
| Smiles | C1C2CC(C1C=C2)(CO)CO |
| Isomeric SMILES | C1C2CC(C1C=C2)(CO)CO |
| Molecular Weight | 154.21 |
| Beilstein | 6(3)4171 |
| Reaxy-Rn | 1862970 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1862970&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 11, 2024 | N134528 | |
| Certificate of Analysis | Nov 11, 2024 | N134528 | |
| Certificate of Analysis | Nov 11, 2024 | N134528 |
| Melt Point(°C) | 112 °C |
|---|---|
| Molecular Weight | 154.210 g/mol |
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 154.099 Da |
| Monoisotopic Mass | 154.099 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 182.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |