Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F489933-100mg
|
100mg |
4
|
$57.90
|
|
|
F489933-250mg
|
250mg |
2
|
$96.90
|
|
| Synonyms | 492444-04-9 | 5-FLUORO-1,3-BENZODIOXOL-4-AMINE | 5-Fluorobenzo[d][1,3]dioxol-4-amine | 5-fluoro-2H-1,3-benzodioxol-4-amine | SCHEMBL1172231 | DTXSID20591905 | HXEMSUWXUXWSHQ-UHFFFAOYSA-N | 5-fluoro-1,3-dioxaindan-4-amine | 6-fluoro-2,3-methylenedioxyaniline | AKOS006330775 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Desiccated |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzodioxoles |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzodioxoles |
| Alternative Parents | Primary aromatic amines Benzenoids Aryl fluorides Oxacyclic compounds Acetals Organopnictogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzodioxole - Aryl fluoride - Aryl halide - Primary aromatic amine - Benzenoid - Acetal - Oxacycle - Primary amine - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzodioxoles. These are organic compounds containing a benzene ring fused to either isomers of dioxole. Dioxole is a five-membered unsaturated ring of two oxygen atoms and three carbon atoms. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488199579 |
|---|---|
| IUPAC Name | 5-fluoro-1,3-benzodioxol-4-amine |
| INCHI | InChI=1S/C7H6FNO2/c8-4-1-2-5-7(6(4)9)11-3-10-5/h1-2H,3,9H2 |
| InChIKey | HXEMSUWXUXWSHQ-UHFFFAOYSA-N |
| Smiles | C1OC2=C(O1)C(=C(C=C2)F)N |
| Isomeric SMILES | C1OC2=C(O1)C(=C(C=C2)F)N |
| Molecular Weight | 155.13 |
| Reaxy-Rn | 9619594 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9619594&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 15, 2024 | F489933 | |
| Certificate of Analysis | May 15, 2024 | F489933 | |
| Certificate of Analysis | May 09, 2024 | F489933 | |
| Certificate of Analysis | May 09, 2024 | F489933 |
| Sensitivity | Moisture Sensitive |
|---|---|
| Molecular Weight | 155.130 g/mol |
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 155.038 Da |
| Monoisotopic Mass | 155.038 Da |
| Topological Polar Surface Area | 44.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 155.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |