Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C190193-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$139.90
|
|
Discover 5-(Chloromethyl)picolinonitrile hydrochloride by Aladdin Scientific in 97% for only $139.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1225380-31-3 | 5-(Chloromethyl)picolinonitrile hydrochloride | 5-(Chloromethyl)pyridine-2-carbonitrile hydrochloride | 5-(chloromethyl)-2-Pyridinecarbonitrile hydrochloride | 5-(chloromethyl)pyridine-2-carbonitrile;hydrochloride | 2-Pyridinecarbonitrile, 5-(chlorom |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Heteroaromatic compounds Nitriles Azacyclic compounds Organochlorides Hydrochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine - Heteroaromatic compound - Azacycle - Nitrile - Carbonitrile - Organic nitrogen compound - Cyanide - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-(chloromethyl)pyridine-2-carbonitrile;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H5ClN2.ClH/c8-3-6-1-2-7(4-9)10-5-6;/h1-2,5H,3H2;1H |
| InChIKey | ZFJZMAXHJRENOK-UHFFFAOYSA-N |
| Smiles | C1=CC(=NC=C1CCl)C#N.Cl |
| Isomeric SMILES | C1=CC(=NC=C1CCl)C#N.Cl |
| Molecular Weight | 189.04 |
| Reaxy-Rn | 22001594 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=22001594&ln= |
| Molecular Weight | 189.040 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 187.991 Da |
| Monoisotopic Mass | 187.991 Da |
| Topological Polar Surface Area | 36.700 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 149.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |