Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C135973-1g
|
1g |
3
|
$59.90
|
|
|
C135973-5g
|
5g |
3
|
$239.90
|
|
| Synonyms | 5-Chloro-isoquinoline |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Isoquinolines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isoquinolines and derivatives |
| Alternative Parents | Pyridines and derivatives Benzenoids Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isoquinoline - Benzenoid - Pyridine - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as isoquinolines and derivatives. These are aromatic polycyclic compounds containing an isoquinoline moiety, which consists of a benzene ring fused to a pyridine ring and forming benzo[c]pyridine. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504757939 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504757939 |
| IUPAC Name | 5-chloroisoquinoline |
| INCHI | InChI=1S/C9H6ClN/c10-9-3-1-2-7-6-11-5-4-8(7)9/h1-6H |
| InChIKey | PJHSMEMFNSINJE-UHFFFAOYSA-N |
| Smiles | C1=CC2=C(C=CN=C2)C(=C1)Cl |
| Isomeric SMILES | C1=CC2=C(C=CN=C2)C(=C1)Cl |
| WGK Germany | 3 |
| Molecular Weight | 163.6 |
| Reaxy-Rn | 114467 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=114467&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 31, 2024 | C135973 | |
| Certificate of Analysis | Aug 31, 2024 | C135973 | |
| Certificate of Analysis | Mar 20, 2024 | C135973 | |
| Certificate of Analysis | Mar 20, 2024 | C135973 | |
| Certificate of Analysis | Jul 17, 2023 | C135973 |
| Solubility | Soluble in Ether, Ethyl Acetate and Methylene Chloride |
|---|---|
| Molecular Weight | 163.600 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 163.019 Da |
| Monoisotopic Mass | 163.019 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |