Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C637408-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$801.90
|
|
| Synonyms | 5-chloro-3-nitro-1H-pyrrolo[3,2-b]pyridine | 1116136-63-0 | 5-Chloro-3-nitro-4-azaindole | SCHEMBL3616218 | AMY9746 | MFCD16876018 | AKOS027253564 | DS-10327 | I10836 | A935525 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyridines |
| Alternative Parents | Nitroaromatic compounds 2-halopyridines Substituted pyrroles Aryl chlorides Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organic zwitterions Organic salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyridine - Nitroaromatic compound - 2-halopyridine - Aryl chloride - Aryl halide - Pyridine - Substituted pyrrole - Heteroaromatic compound - Pyrrole - C-nitro compound - Organic nitro compound - Organic oxoazanium - Azacycle - Organic 1,3-dipolar compound - Allyl-type 1,3-dipolar organic compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organic salt - Organic oxygen compound - Organic zwitterion - Organic oxide - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyridines. These are compounds containing a pyrrolopyridine moiety, which consists of a pyrrole ring fused to a pyridine. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyridine is a 6-membered ring consisting of five carbon atoms and one nitrogen center. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-chloro-3-nitro-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| INCHI | InChI=1S/C7H4ClN3O2/c8-6-2-1-4-7(10-6)5(3-9-4)11(12)13/h1-3,9H |
| InChIKey | ZVKDTXRWTRDHMC-UHFFFAOYSA-N |
| Smiles | C1=CC(=NC2=C1NC=C2[N+](=O)[O-])Cl |
| Isomeric SMILES | C1=CC(=NC2=C1NC=C2[N+](=O)[O-])Cl |
| PubChem CID | 57613574 |
| Molecular Weight | 197.58 |
| Molecular Weight | 197.580 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 196.999 Da |
| Monoisotopic Mass | 196.999 Da |
| Topological Polar Surface Area | 74.500 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 220.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |