Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B631635-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$157.90
|
|
|
B631635-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$251.90
|
|
|
B631635-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$419.90
|
|
|
B631635-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$629.90
|
|
|
B631635-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,151.90
|
|
| Synonyms | 5-Bromo-8-methyl-1,7-naphthyridine | 2101944-54-9 | MFCD31617945 | SCHEMBL18980400 | AKOS037630815 | AS-77584 | SY233105 | P18754 | A924495 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| IUPAC Name | 5-bromo-8-methyl-1,7-naphthyridine |
|---|---|
| INCHI | InChI=1S/C9H7BrN2/c1-6-9-7(3-2-4-11-9)8(10)5-12-6/h2-5H,1H3 |
| InChIKey | GTCFMEWJJCELPN-UHFFFAOYSA-N |
| Smiles | CC1=NC=C(C2=C1N=CC=C2)Br |
| PubChem CID | 129240987 |
| Molecular Weight | 223.07 |
| Molecular Weight | 223.070 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 221.979 Da |
| Monoisotopic Mass | 221.979 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 163.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |