Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B631545-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$96.90
|
|
|
B631545-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$193.90
|
|
|
B631545-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$322.90
|
|
|
B631545-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$484.90
|
|
|
B631545-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,426.90
|
|
| Synonyms | 5-Bromo-6-fluoro-2-methyl-2h-indazole | 2091272-22-7 | 5-bromo-6-fluoro-2-methylindazole | SCHEMBL21631704 | MFCD30802371 | PB41807 | BS-43003 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| IUPAC Name | 5-bromo-6-fluoro-2-methylindazole |
|---|---|
| INCHI | InChI=1S/C8H6BrFN2/c1-12-4-5-2-6(9)7(10)3-8(5)11-12/h2-4H,1H3 |
| InChIKey | ROOLMMOBFMVQTM-UHFFFAOYSA-N |
| Smiles | CN1C=C2C=C(C(=CC2=N1)F)Br |
| PubChem CID | 131489264 |
| Molecular Weight | 229.05 |
| Molecular Weight | 229.050 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 227.97 Da |
| Monoisotopic Mass | 227.97 Da |
| Topological Polar Surface Area | 17.800 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 178.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |