Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B194037-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$17.90
|
|
|
B194037-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$57.90
|
|
|
B194037-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$299.90
|
|
|
B194037-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,296.90
|
|
Discover 5-Bromo-2-cyclopropylpyridine by Aladdin Scientific in 98% for only $17.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 5-Bromo-2-cyclopropylpyridine | 579475-29-9 | 3-Bromo-6-(cyclopropyl)pyridine | MFCD12033369 | 5-Bromo-2-cyclopropyl-pyridine | SCHEMBL588122 | DTXSID10624690 | WLJWEZIWWHAIEM-UHFFFAOYSA-N | AKOS015943386 | AB65328 | CS-W022305 | DS-17229 | SY118891 | FT-0763508 | EN300-211291 | A8504 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Aryl bromides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine - Aryl halide - Aryl bromide - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organobromide - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-bromo-2-cyclopropylpyridine |
|---|---|
| INCHI | InChI=1S/C8H8BrN/c9-7-3-4-8(10-5-7)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | WLJWEZIWWHAIEM-UHFFFAOYSA-N |
| Smiles | C1CC1C2=NC=C(C=C2)Br |
| Isomeric SMILES | C1CC1C2=NC=C(C=C2)Br |
| Molecular Weight | 198.06 |
| Reaxy-Rn | 8049793 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8049793&ln= |
| Molecular Weight | 198.060 g/mol |
|---|---|
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 196.984 Da |
| Monoisotopic Mass | 196.984 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 122.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |