Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B635967-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$204.90
|
|
| Synonyms | 552287-64-6 | 5-bromo-2-(2-{[2-(trimethylsilyl)ethoxy]methoxy}propan-2-yl)pyridine | Pyridine, 5-bromo-2-[1-methyl-1-[[2-(trimethylsilyl)ethoxy]methoxy]ethyl]- | 5-bromo-2-(2-{[2-(trimethylsilyl)ethoxy]methoxypropan-2-yl)pyridine | 2-[2-(5-bromopyridin-2- |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Aryl bromides Heteroaromatic compounds Organic metalloid salts Azacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl bromide - Aryl halide - Pyridine - Heteroaromatic compound - Acetal - Organic metalloid salt - Azacycle - Organosilicon compound - Alkylsilane - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organobromide - Organic metalloid moeity - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-[2-(5-bromopyridin-2-yl)propan-2-yloxymethoxy]ethyl-trimethylsilane |
|---|---|
| INCHI | InChI=1S/C14H24BrNO2Si/c1-14(2,13-7-6-12(15)10-16-13)18-11-17-8-9-19(3,4)5/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | QRORWWGRTFDWEG-UHFFFAOYSA-N |
| Smiles | CC(C)(C1=NC=C(C=C1)Br)OCOCC[Si](C)(C)C |
| Isomeric SMILES | CC(C)(C1=NC=C(C=C1)Br)OCOCC[Si](C)(C)C |
| PubChem CID | 10860910 |
| Molecular Weight | 346.34 |
| Molecular Weight | 346.330 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 7 |
| Exact Mass | 345.076 Da |
| Monoisotopic Mass | 345.076 Da |
| Topological Polar Surface Area | 31.400 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 269.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |