Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B180537-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,271.90
|
|
|
B180537-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,571.90
|
|
Discover 5-Bromo-2-(2,2,2-trifluoroethyl)aminopyrimidine by Aladdin Scientific in 98% for only $1,271.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1245563-08-9 | 5-Bromo-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine | 5-BROMO-2-(2,2,2-TRIFLUOROETHYL)AMINOPYRIMIDINE | SCHEMBL19552131 | DTXSID70682458 | XAHKWJXWKQLGSJ-UHFFFAOYSA-N | MFCD17015846 | AKOS013186680 | SB58481 | BS-19620 | CS-0443027 | A890491 | 2-Pyrimidinamine, 5-br |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Halopyrimidines |
| Alternative Parents | Aminopyrimidines and derivatives Aryl bromides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organofluorides Organobromides Hydrocarbon derivatives Amines Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminopyrimidine - Halopyrimidine - Aryl bromide - Aryl halide - Heteroaromatic compound - Azacycle - Alkyl fluoride - Organofluoride - Organobromide - Organohalogen compound - Organonitrogen compound - Hydrocarbon derivative - Organopnictogen compound - Organic nitrogen compound - Amine - Alkyl halide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as halopyrimidines. These are aromatic compounds containing a halogen atom linked to a pyrimidine ring. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-bromo-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
|---|---|
| INCHI | InChI=1S/C6H5BrF3N3/c7-4-1-11-5(12-2-4)13-3-6(8,9)10/h1-2H,3H2,(H,11,12,13) |
| InChIKey | XAHKWJXWKQLGSJ-UHFFFAOYSA-N |
| Smiles | C1=C(C=NC(=N1)NCC(F)(F)F)Br |
| Isomeric SMILES | C1=C(C=NC(=N1)NCC(F)(F)F)Br |
| Molecular Weight | 256 |
| Reaxy-Rn | 32226905 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=32226905&ln= |
| Molecular Weight | 256.019 g/mol |
|---|---|
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 254.962 Da |
| Monoisotopic Mass | 254.962 Da |
| Topological Polar Surface Area | 37.800 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 156.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |