Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B174514-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$67.90
|
|
Discover 5-bromo-1-methyl-3-nitro-1,2-dihydropyridin-2-one by Aladdin Scientific in 97% for only $67.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 5-Bromo-1-methyl-3-nitropyridin-2(1H)-one | 153888-45-0 | 5-bromo-1-methyl-3-nitro-1,2-dihydropyridin-2-one | 5-bromo-1-methyl-3-nitropyridin-2-one | MFCD09835081 | SCHEMBL255765 | DTXSID70680575 | VFWZQRFZMKHGOY-UHFFFAOYSA-N | AKOS015850728 | AKOS034830304 | SB10150 | AM80326 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Class | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Organic nitro compounds |
| Intermediate Tree Nodes | C-nitro compounds |
| Direct Parent | Nitroaromatic compounds |
| Alternative Parents | Pyridinones Dihydropyridines Aryl bromides Heteroaromatic compounds Lactams Propargyl-type 1,3-dipolar organic compounds Azacyclic compounds Organic oxoazanium compounds Organopnictogen compounds Organic oxides Organic salts Hydrocarbon derivatives Organobromides Organonitrogen compounds Organooxygen compounds Organic cations |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - Dihydropyridine - Pyridinone - Aryl bromide - Aryl halide - Hydropyridine - Pyridine - Heteroaromatic compound - Lactam - Organoheterocyclic compound - Azacycle - Propargyl-type 1,3-dipolar organic compound - Organic oxoazanium - Organic salt - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organic cation - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-bromo-1-methyl-3-nitropyridin-2-one |
|---|---|
| INCHI | InChI=1S/C6H5BrN2O3/c1-8-3-4(7)2-5(6(8)10)9(11)12/h2-3H,1H3 |
| InChIKey | VFWZQRFZMKHGOY-UHFFFAOYSA-N |
| Smiles | CN1C=C(C=C(C1=O)[N+](=O)[O-])Br |
| Isomeric SMILES | CN1C=C(C=C(C1=O)[N+](=O)[O-])Br |
| Molecular Weight | 233.02 |
| Reaxy-Rn | 15020647 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15020647&ln= |
| Molecular Weight | 233.020 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 231.948 Da |
| Monoisotopic Mass | 231.948 Da |
| Topological Polar Surface Area | 66.100 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 302.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |