Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A176275-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$157.90
|
|
Discover 5-azaspiro[2.4]heptane hydrochloride by Aladdin Scientific in 97% for only $157.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 5-Azaspiro[2.4]heptane hydrochloride | 3659-21-0 | 5-AZASPIRO[2.4]HEPTANE HCL | 5-azaspiro[2.4]heptane;hydrochloride | 5-Aza-Spiro[2.4]heptane hydrochloride | MFCD21099571 | SCHEMBL15537634 | DTXSID50743415 | NCTCZAISXOQDKD-UHFFFAOYSA-N | AMY26252 | 5-Azaspiro[2.4]heptanehyd |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolidines |
| Alternative Parents | Dialkylamines Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Pyrrolidine - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Amine - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolidines. These are compounds containing a pyrrolidine ring, which is a five-membered saturated aliphatic heterocycle with one nitrogen atom and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-azaspiro[2.4]heptane;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H11N.ClH/c1-2-6(1)3-4-7-5-6;/h7H,1-5H2;1H |
| InChIKey | NCTCZAISXOQDKD-UHFFFAOYSA-N |
| Smiles | C1CC12CCNC2.Cl |
| Isomeric SMILES | C1CC12CCNC2.Cl |
| Molecular Weight | 133.619 |
| Reaxy-Rn | 28251424 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=28251424&ln= |
| Molecular Weight | 133.620 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 133.066 Da |
| Monoisotopic Mass | 133.066 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 84.200 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |