Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A304217-250mg
|
250mg |
3
|
$37.90
|
|
|
A304217-1g
|
1g |
3
|
$104.90
|
|
|
A304217-5g
|
5g |
2
|
$434.90
|
|
| Synonyms | 5-aminobenzene-1,3-diol hydrochloride | 6318-56-5 | 5-aminobenzene-1,3-diol;hydrochloride | 1,3-Benzenediol, 5-amino-, hydrochloride | 5-Aminobenzene-1,3-diol, HCl | MFCD00662897 | 5-Aminoresorcinol, hydrochloride | 5-AMINOBENZENE-1,3-DIOL HCL | SCHEMBL3182688 | DTXSID4033 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenols |
| Subclass | Benzenediols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Resorcinols |
| Alternative Parents | m-Aminophenols Aniline and substituted anilines 1-hydroxy-4-unsubstituted benzenoids 1-hydroxy-2-unsubstituted benzenoids Primary amines Organopnictogen compounds Organooxygen compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminophenol - M-aminophenol - Resorcinol - Aniline or substituted anilines - 1-hydroxy-4-unsubstituted benzenoid - 1-hydroxy-2-unsubstituted benzenoid - Monocyclic benzene moiety - Amine - Hydrocarbon derivative - Hydrochloride - Organopnictogen compound - Primary amine - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as resorcinols. These are compounds containing a resorcinol moiety, which is a benzene ring bearing two hydroxyl groups at positions 1 and 3. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504758912 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758912 |
| IUPAC Name | 5-aminobenzene-1,3-diol;hydrochloride |
| INCHI | InChI=1S/C6H7NO2.ClH/c7-4-1-5(8)3-6(9)2-4;/h1-3,8-9H,7H2;1H |
| InChIKey | VNZZCDQPCQIUGG-UHFFFAOYSA-N |
| Smiles | C1=C(C=C(C=C1O)O)N.Cl |
| Isomeric SMILES | C1=C(C=C(C=C1O)O)N.Cl |
| Molecular Weight | 161.59 |
| Reaxy-Rn | 5114284 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5114284&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 20, 2024 | A304217 | |
| Certificate of Analysis | Sep 20, 2024 | A304217 | |
| Certificate of Analysis | Sep 20, 2024 | A304217 |
| Melt Point(°C) | 182ºC |
|---|---|
| Molecular Weight | 161.580 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 161.024 Da |
| Monoisotopic Mass | 161.024 Da |
| Topological Polar Surface Area | 66.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 87.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |