Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M629967-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$189.90
|
|
|
M629967-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$284.90
|
|
|
M629967-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$379.90
|
|
|
M629967-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$571.90
|
|
| Synonyms | 4-methoxy-4-methylcyclohexane-1-carbaldehyde | 1637310-67-8 | SCHEMBL16213245 | MFCD28501639 | PB41008 | AS-78892 | CS-0056313 | P14808 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| IUPAC Name | 4-methoxy-4-methylcyclohexane-1-carbaldehyde |
|---|---|
| INCHI | InChI=1S/C9H16O2/c1-9(11-2)5-3-8(7-10)4-6-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | UVQCVROSPMFDGF-UHFFFAOYSA-N |
| Smiles | CC1(CCC(CC1)C=O)OC |
| Isomeric SMILES | CC1(CCC(CC1)C=O)OC |
| PubChem CID | 117679987 |
| Molecular Weight | 156.22 |
| Molecular Weight | 156.220 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 156.115 Da |
| Monoisotopic Mass | 156.115 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 134.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |