Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M479498-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$494.90
|
|
| Synonyms | AG-205/25005622 | 4-Methoxy-1,2,5-oxadiazol-3-amine, AldrichCPR | 4-methoxy-1,2,5-oxadiazole-3-ylamine | 4-Methoxy-furazan-3-ylamine | DTXSID30341736 | 4-Methoxy-1,2,5-oxadiazol-3-amine | 4-methoxy-1,2,5-oxadiazol-3-ylamine | BS-36220 | 3-Amino-4-methoxyf |
|---|---|
| Specifications & Purity | Reagent grade |
| Legal Information | Product of ChemBridge Corp. |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl aryl ethers |
| Alternative Parents | Imidolactams Heteroaromatic compounds Furazans Azacyclic compounds Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl aryl ether - Imidolactam - Heteroaromatic compound - Oxadiazole - Furazan - Azole - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl aryl ethers. These are organic compounds containing the alkyl aryl ether functional group with the generic formula R-O-R' , where R is an alkyl group and R' is an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-methoxy-1,2,5-oxadiazol-3-amine |
|---|---|
| INCHI | InChI=1S/C3H5N3O2/c1-7-3-2(4)5-8-6-3/h1H3,(H2,4,5) |
| InChIKey | BZXHBVIPEFVWOR-UHFFFAOYSA-N |
| Smiles | COC1=NON=C1N |
| Isomeric SMILES | COC1=NON=C1N |
| Molecular Weight | 115.09 |
| Reaxy-Rn | 4376471 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4376471&ln= |
| Molecular Weight | 115.090 g/mol |
|---|---|
| XLogP3 | -0.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 115.038 Da |
| Monoisotopic Mass | 115.038 Da |
| Topological Polar Surface Area | 74.200 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 78.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |