Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I137218-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$303.90
|
|
Discover 4’-Isobutylacetophenone by Aladdin Scientific in USP for only $303.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4'-Isobutylacetophenone | 38861-78-8 | 4-Isobutylacetophenone | 1-(4-Isobutylphenyl)ethanone | p-iso-Butylacetophenone | p-Isobutylacetophenone | 1-[4-(2-methylpropyl)phenyl]ethanone | Ethanone, 1-[4-(2-methylpropyl)phenyl]- | 1-[4-(2-methylpropyl)phenyl]ethan-1-one | 4'-( |
|---|---|
| Specifications & Purity | PharmPure™, USP |
| Shipped In | Normal |
| Grade | USP |
| Product Description |
A useful biochemical for proteomics research |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | Phenylpropanes Acetophenones Benzoyl derivatives Aryl alkyl ketones Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkyl-phenylketone - Phenylpropane - Acetophenone - Aryl alkyl ketone - Benzoyl - Benzenoid - Monocyclic benzene moiety - Organic oxide - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-[4-(2-methylpropyl)phenyl]ethanone |
|---|---|
| INCHI | InChI=1S/C12H16O/c1-9(2)8-11-4-6-12(7-5-11)10(3)13/h4-7,9H,8H2,1-3H3 |
| InChIKey | KEAGRYYGYWZVPC-UHFFFAOYSA-N |
| Smiles | CC(C)CC1=CC=C(C=C1)C(=O)C |
| Isomeric SMILES | CC(C)CC1=CC=C(C=C1)C(=O)C |
| Molecular Weight | 176.26 |
| Reaxy-Rn | 1935275 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1935275&ln= |
| Refractive Index | 1.52 |
|---|---|
| Flash Point(°F) | 129°F |
| Flash Point(°C) | 54°C |
| Boil Point(°C) | 268 °C |
| Molecular Weight | 176.250 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 176.12 Da |
| Monoisotopic Mass | 176.12 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 164.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |