Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B301222-1g
|
1g |
5
|
$103.90
|
|
| Synonyms | Oprea1_723416 | 4-hydroxybutanohydrazide | F87408 | STK699073 | EN300-20821 | 4-Hydroxybutanoyl hydrazine | BBL009673 | MFCD00051702 | 4-hydroxybutanoic acid hydrazide | 4-Hydroxybutyric acid hydrazide, AldrichCPR | SCHEMBL735203 | BP-11482 | Butanoic aci |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Protected from light |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acid hydrazides |
| Alternative Parents | Primary alcohols Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Carboxylic acid hydrazide - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acid hydrazides. These are carboxylic acid derivatives containing a carbonyl group in which the carbon is directly linked to a hydrazide group (N-N). |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504757894 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504757894 |
| IUPAC Name | 4-hydroxybutanehydrazide |
| INCHI | InChI=1S/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8) |
| InChIKey | WOXQFPPKZBOSTN-UHFFFAOYSA-N |
| Smiles | C(CC(=O)NN)CO |
| Isomeric SMILES | C(CC(=O)NN)CO |
| Molecular Weight | 118.14 |
| Reaxy-Rn | 1749234 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1749234&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 01, 2022 | B301222 |
| Sensitivity | light sensitive |
|---|---|
| Melt Point(°C) | 91-95°C |
| Molecular Weight | 118.130 g/mol |
| XLogP3 | -1.800 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 118.074 Da |
| Monoisotopic Mass | 118.074 Da |
| Topological Polar Surface Area | 75.400 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 74.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |