Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E156291-1g
|
1g |
5
|
$219.90
|
|
|
E156291-5g
|
5g |
3
|
$737.90
|
|
| Synonyms | SCHEMBL278397 | DTXSID40462229 | YCA81976 | A925890 | FT-0692719 | MFCD06200801 | 4-Ethynylphthalic Anhydride | T72893 | C10H4O3 | E0579 | 5-ethynyl-1,3-dihydro-2-benzofuran-1,3-dione | 5-ETHYNYL-2-BENZOFURAN-1,3-DIONE | 5-ethynylisobenzofuran-1,3-dione | |
|---|---|
| Specifications & Purity | ≥98%(GC) |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzofurans |
| Subclass | Benzofuranones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phthalic anhydrides |
| Alternative Parents | Isobenzofuranones Dicarboxylic acids and derivatives Benzenoids Carboxylic acid anhydrides Oxacyclic compounds Acetylides Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Phthalic anhydride - Phthalic_anhydride - Isobenzofuranone - Isocoumaran - Benzenoid - Dicarboxylic acid or derivatives - Carboxylic acid anhydride - Acetylide - Oxacycle - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as phthalic anhydrides. These are compounds containing a phthalic anhydride moiety (or a derivative thereof), which consists of a benzene fused to a furan-1,3-dione. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488197399 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488197399 |
| IUPAC Name | 5-ethynyl-2-benzofuran-1,3-dione |
| INCHI | InChI=1S/C10H4O3/c1-2-6-3-4-7-8(5-6)10(12)13-9(7)11/h1,3-5H |
| InChIKey | DXJLXGJIZZNCBO-UHFFFAOYSA-N |
| Smiles | C#CC1=CC2=C(C=C1)C(=O)OC2=O |
| Isomeric SMILES | C#CC1=CC2=C(C=C1)C(=O)OC2=O |
| Molecular Weight | 172.14 |
| Reaxy-Rn | 4394265 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4394265&ln= |
| Solubility | Soluble in Tetrahydrofuran |
|---|---|
| Sensitivity | Moisture sensitive |
| Melt Point(°C) | 125 ° |
| Molecular Weight | 172.140 g/mol |
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 172.016 Da |
| Monoisotopic Mass | 172.016 Da |
| Topological Polar Surface Area | 43.400 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 309.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yin Lu, Xinye Yu, Corey J. Evans, Shengfu Yang, Kan Zhang. (2021) Elucidating the role of acetylene in ortho-phthalimide functional benzoxazines: design, synthesis, and structure–property investigations. Polymer Chemistry, 12 (35): (5059-5068). |